![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 12 12 The Day .mkv | 2024-07-30 16:59 | 742M | |
| 20th Century Girl .mkv | 2022-10-27 13:42 | 1.4G | |
| 720 Once a Week .mkv | 2022-04-26 13:05 | 159M | |
| 1987 When The Day Co..> | 2022-04-18 18:07 | 2.1G | |
| A Bittersweet Life .mp4 | 2023-07-23 14:28 | 2.2G | |
| A Dogs Courage .mp4 | 2022-01-31 17:47 | 937M | |
| A Frozen Flower .mp4 | 2023-07-23 15:24 | 1.2G | |
| A Hard Day .mkv | 2024-09-22 18:17 | 1.0G | |
| A Little Princess .mp4 | 2022-02-01 12:46 | 959M | |
| A Melody To Remember..> | 2022-01-31 16:24 | 1.1G | |
| A Melody To Remember..> | 2022-04-18 18:00 | 1.1G | |
| A Millionaire On The..> | 2022-01-31 14:28 | 1.0G | |
| A Tale Of Two Sister..> | 2023-07-23 14:19 | 968M | |
| A Taxi Driver .mkv | 2023-11-03 23:29 | 2.3G | |
| A Writers Odyssey .mp4 | 2022-04-19 13:10 | 1.2G | |
| Acusada .mkv | 2022-04-26 13:06 | 945M | |
| Adam By Eve A Live I..> | 2022-04-19 15:30 | 541M | |
| Alienoid .mkv | 2024-01-18 17:10 | 2.2G | |
| Alienoid .mp4 | 2023-01-12 18:00 | 1.3G | |
| Alienoid Return to t..> | 2024-07-30 16:58 | 649M | |
| Alienoid The Return ..> | 2024-02-23 16:01 | 4.0G | |
| Along With The Gods ..> | 2022-01-31 18:39 | 1.2G | |
| Along With The Gods ..> | 2022-01-31 17:23 | 1.2G | |
| An Ethics Lesson .mp4 | 2022-01-31 14:49 | 1.0G | |
| Anchor .mp4 | 2023-01-12 17:59 | 1.0G | |
| Around The Table .mp4 | 2022-04-19 13:10 | 962M | |
| Asakusa Kid .mp4 | 2022-04-19 13:10 | 902M | |
| Ashfall .mp4 | 2022-02-01 14:31 | 704M | |
| Assassination .mkv | 2022-04-24 12:41 | 1.0G | |
| Baby Beside Me .mp4 | 2022-01-31 17:21 | 1.0G | |
| Badland Hunters .mkv | 2024-01-27 18:33 | 2.2G | |
| Ballerina.mkv | 2023-10-17 19:41 | 1.8G | |
| Battlefield.mkv | 2023-10-17 19:28 | 1.0G | |
| Battlefield Heroes .mp4 | 2022-01-31 14:09 | 1.1G | |
| Believer .mkv | 2023-11-29 18:46 | 1.7G | |
| Best Friend .mp4 | 2022-02-01 15:49 | 1.2G | |
| Blackpink Light Up T..> | 2022-02-01 17:32 | 730M | |
| Bo Gia .mp4 | 2022-04-19 13:10 | 1.1G | |
| Bodyguard .mkv | 2023-09-22 16:19 | 1.3G | |
| Bogota City of the L..> | 2025-02-06 20:24 | 1.0G | |
| Boogie Nights .mp4 | 2023-01-12 17:56 | 813M | |
| Born To Fly .mp4 | 2023-10-01 16:56 | 1.1G | |
| Botanical Books .mp4 | 2022-01-31 16:46 | 2.1G | |
| Brave Citizen .mkv | 2024-03-20 14:45 | 592M | |
| Brave Gunjyo Senki .mp4 | 2022-04-19 13:11 | 1.0G | |
| Broker .mkv | 2023-08-15 14:52 | 2.2G | |
| Bubble .mkv | 2022-04-30 10:15 | 2.7G | |
| Burning .mp4 | 2022-04-19 12:39 | 1.2G | |
| Circle Of Atonement ..> | 2022-01-31 15:47 | 937M | |
| Closer To Heaven .mp4 | 2023-07-23 15:51 | 1.1G | |
| Cold Eyes .mp4 | 2022-01-31 14:50 | 1.1G | |
| Concrete Utopia .mkv | 2024-07-30 16:59 | 753M | |
| Confession Of Murder..> | 2022-01-31 14:29 | 1.0G | |
| Confidential Assignm..> | 2022-11-11 18:11 | 1.5G | |
| Control.Z.S01E01.720..> | 2020-05-22 22:21 | 229M | |
| Decision To Leave .mp4 | 2023-01-12 17:59 | 1.2G | |
| Deep.mp4 | 2022-02-19 15:06 | 930M | |
| Deliverb Us From Evi..> | 2022-04-19 12:51 | 1.0G | |
| Derailed .mkv | 2022-04-24 12:44 | 771M | |
| Derailed .mp4 | 2022-04-18 18:00 | 840M | |
| Deranged .mkv | 2022-04-24 12:18 | 850M | |
| Detective Chinatown ..> | 2022-04-19 13:12 | 1.2G | |
| Detective K Secret O..> | 2022-01-31 18:56 | 2.2G | |
| Dine with Love-Monvo..> | 2025-01-07 17:48 | 773M | |
| Dont Click.mp4 | 2022-01-31 14:30 | 858M | |
| Dont Listen .mkv | 2022-02-02 16:41 | 937M | |
| Door Lock .mkv | 2025-02-06 20:25 | 911M | |
| Dragon Wars D War .mp4 | 2023-07-23 15:19 | 1.7G | |
| Dream .mkv | 2023-08-15 14:41 | 1.0G | |
| Drive My Car .mp4 | 2022-04-19 13:13 | 3.3G | |
| Dwae-ji-ui Wang .mp4 | 2022-01-31 14:07 | 888M | |
| Dynasty Warriors .mp4 | 2022-04-19 13:14 | 1.1G | |
| Emergency Declaratio..> | 2022-11-25 16:31 | 2.3G | |
| Empire Of Lust .mp4 | 2022-01-31 15:58 | 1.0G | |
| End Game .mp4 | 2022-04-19 13:14 | 1.1G | |
| Endless Rain .mp4 | 2022-04-19 13:15 | 1.1G | |
| Entre Sabanas .mkv | 2022-01-31 12:50 | 296M | |
| Escape From Mogadish..> | 2022-02-19 15:04 | 1.0G | |
| Exhuma.2024.Dual.720..> | 2024-10-02 18:35 | 762M | |
| Exit .mkv | 2025-02-06 20:21 | 800M | |
| Exit .mp4 | 2022-04-19 12:43 | 952M | |
| Extreme Job .mp4 | 2022-02-01 13:42 | 1.0G | |
| Eye for an Eye .mp4 | 2022-02-02 16:24 | 590M | |
| Fernando Torres The ..> | 2022-02-02 16:42 | 951M | |
| Fever Dream .mp4 | 2022-04-26 12:48 | 734M | |
| First Love .mp4 | 2022-04-19 13:16 | 1.1G | |
| Flu .mp4 | 2022-01-31 15:05 | 1.1G | |
| Followers .mp4 | 2022-02-19 14:49 | 702M | |
| Food Luck .mp4 | 2022-02-01 15:47 | 963M | |
| Forgotten .mp4 | 2022-04-18 18:07 | 1.0G | |
| Gangnam Zombie .mkv | 2023-07-12 14:50 | 1.3G | |
| Gatao The Last Stray..> | 2022-04-19 13:16 | 1.1G | |
| Ghost Lab .mp4 | 2022-04-19 13:17 | 1.1G | |
| Ghost Walk .mp4 | 2022-01-31 17:49 | 826M | |
| Girlfriend Boyfriend..> | 2022-01-31 14:52 | 2.0G | |
| Glory Day .mp4 | 2022-01-31 15:47 | 855M | |
| Go Back .mp4 | 2022-02-01 17:33 | 910M | |
| Go Seppuku Yourselve..> | 2022-02-19 14:29 | 242M | |
| Good Morning Preside..> | 2023-07-23 15:52 | 1.2G | |
| Grumpy Christmas .mp4 | 2022-04-26 12:44 | 1.6G | |
| HARD HIT .mkv | 2023-05-09 14:33 | 950M | |
| Hansan .mkv | 2022-11-25 16:31 | 2.2G | |
| Hard Hit.mp4 | 2022-04-19 13:18 | 1.6G | |
| Have A Song On Your ..> | 2022-01-31 16:07 | 2.4G | |
| Heart Blackened .mp4 | 2022-04-18 18:07 | 1.1G | |
| Heist of The Century..> | 2022-02-02 16:32 | 2.2G | |
| High Society .mp4 | 2022-01-31 18:33 | 1.2G | |
| Hijack 1971 .mkv | 2024-10-02 18:32 | 795M | |
| Hill Of Freedom .mp4 | 2022-01-31 15:19 | 615M | |
| Hindsight .mp4 | 2022-04-23 18:19 | 758M | |
| Hit-and-Run Squad .mp4 | 2022-02-01 14:09 | 1.6G | |
| Home Sweet Home .mp4 | 2022-04-19 13:17 | 1.0G | |
| Homestay .mp4 | 2022-02-23 12:59 | 1.0G | |
| Homunculus .mp4 | 2022-04-19 13:18 | 1.0G | |
| Hope .mkv | 2022-04-24 12:44 | 2.3G | |
| Hot Young Bloods .mkv | 2024-12-23 14:57 | 1.0G | |
| How To Fall In Love ..> | 2024-03-20 14:44 | 591M | |
| I Don't Like Younger..> | 2022-04-23 17:43 | 943M | |
| I Saw The Devil (2)..> | 2022-04-18 17:34 | 2.6G | |
| I Saw The Devil .mp4 | 2022-01-31 13:51 | 1.3G | |
| I Want to Know Your ..> | 2022-06-22 13:36 | 1.7G | |
| Illang The Wolf Brig..> | 2022-01-31 19:26 | 2.2G | |
| Inside Men .mp4 | 2022-01-31 15:56 | 1.6G | |
| Invisible Alien .mp4 | 2022-04-19 13:17 | 451M | |
| Iron Girl Ultimate W..> | 2022-01-31 15:43 | 773M | |
| Island .mp4 | 2023-05-30 17:41 | 514M | |
| Jo Pil ho The Dawnin..> | 2022-02-01 13:51 | 1.1G | |
| Joint Security Area ..> | 2023-07-23 15:56 | 2.0G | |
| Journey To The West ..> | 2023-05-30 17:41 | 876M | |
| Kakegurui Part 2 Des..> | 2023-05-30 17:43 | 1.1G | |
| Kidnapped .mkv | 2022-02-02 16:32 | 745M | |
| Killed My Wife .mp4 | 2022-02-01 12:51 | 898M | |
| Kim Ji young Born198..> | 2022-02-01 13:55 | 1.1G | |
| Kingdom Ashin Of The..> | 2022-04-19 13:18 | 860M | |
| Last Child .mp4 | 2022-01-31 17:05 | 1.1G | |
| Last Of The Wolves .mp4 | 2022-04-19 13:19 | 1.3G | |
| Lee Su geun The Sens..> | 2022-04-19 13:18 | 422M | |
| Life Is Beautiful.mkv | 2024-10-02 18:36 | 1.1G | |
| Limit .mp4 | 2023-01-22 14:47 | 805M | |
| Lingering.mp4 | 2022-04-19 12:52 | 927M | |
| Long Live The King .mp4 | 2022-02-01 13:16 | 1.1G | |
| Love Fiction.mp4 | 2022-01-31 14:32 | 1.1G | |
| Love Lies .mp4 | 2022-01-31 16:40 | 1.1G | |
| Lovers Vanished.mp4 | 2022-01-31 13:47 | 964M | |
| Man In Love .mp4 | 2022-01-31 15:26 | 1.1G | |
| Man Of Men.mkv | 2024-04-04 15:40 | 611M | |
| Mat Kilau .mkv | 2022-11-20 14:26 | 1.8G | |
| Me And Me .mp4 | 2022-04-19 12:52 | 964M | |
| Memories Of Murder .mp4 | 2023-07-23 14:09 | 2.4G | |
| Midnight .mkv | 2022-06-22 13:43 | 1.8G | |
| Midnight .mp4 | 2022-04-19 12:57 | 950M | |
| Midnight FM .mp4 | 2022-01-31 13:48 | 950M | |
| Minari .mkv | 2022-01-20 10:55 | 726M | |
| Miracle In Cell No 7..> | 2022-01-31 15:05 | 1.1G | |
| Mirapakai .mkv | 2022-04-19 15:39 | 1.1G | |
| Miss Baek .mp4 | 2022-01-31 18:46 | 835M | |
| Mission Cross .mkv | 2024-09-22 18:14 | 1.0G | |
| Mission Possible .mp4 | 2022-04-19 13:18 | 851M | |
| Money .mp4 | 2022-04-19 12:45 | 1.0G | |
| Monstrum .mp4 | 2022-01-31 18:47 | 970M | |
| Montage .mp4 | 2022-04-18 17:49 | 2.1G | |
| Mood Of The Day .mp4 | 2022-01-31 16:22 | 951M | |
| More Than Blue .mp4 | 2022-04-24 14:15 | 1.1G | |
| Mr Go .mp4 | 2022-01-31 14:51 | 1.2G | |
| Murderer .mkv | 2024-03-20 14:47 | 441M | |
| My Bossy Girl .mp4 | 2022-02-01 13:15 | 918M | |
| My Brilliant Life .mkv | 2024-11-24 15:56 | 923M | |
| My Captain Mr Underg..> | 2023-07-23 15:06 | 960M | |
| My Dictator .mp4 | 2022-01-31 15:24 | 1.2G | |
| My Fathers Violin .mp4 | 2022-04-28 19:24 | 1.6G | |
| My First Client .mp4 | 2022-02-01 13:47 | 1.0G | |
| My Name Is Loh Kiwan..> | 2024-03-20 14:46 | 737M | |
| My New Sassy Girl .mp4 | 2022-01-31 16:22 | 878M | |
| My Way .mkv | 2023-12-07 18:34 | 2.6G | |
| My Way .mp4 | 2022-01-31 14:12 | 1.8G | |
| My Wife Got Married ..> | 2023-07-23 15:24 | 1.1G | |
| My Wife Is a Gangste..> | 2023-07-23 13:55 | 1.4G | |
| Nagi Machi .mp4 | 2022-02-01 12:39 | 1.1G | |
| Natalie .mkv | 2022-04-23 18:30 | 914M | |
| Natural City .mp4 | 2023-07-23 14:10 | 1.0G | |
| New Year Blues .mp4 | 2022-04-19 13:19 | 1.0G | |
| Night In Paradise .mp4 | 2022-01-20 10:56 | 1.2G | |
| Nobodys Daughter Hae..> | 2022-04-24 12:29 | 1.1G | |
| Noryang Jugeumui Bad..> | 2024-07-30 17:01 | 938M | |
| Obsessed .mp4 | 2022-01-31 15:24 | 1.2G | |
| Ode To My Father .mp4 | 2022-01-31 15:32 | 1.1G | |
| Offering to the Stor..> | 2022-02-02 16:29 | 1.5G | |
| Oh Boarding House .mp4 | 2023-01-12 17:58 | 947M | |
| Oldboy .mp4 | 2023-07-23 14:06 | 1.9G | |
| Operation Red Sea .mp4 | 2022-04-19 12:38 | 2.2G | |
| Our Love Story .mp4 | 2022-01-31 16:19 | 908M | |
| Our Sunhi .mp4 | 2022-01-31 14:48 | 810M | |
| Pandora .mkv | 2022-04-24 12:43 | 852M | |
| Pandora .mp4 | 2022-01-31 16:24 | 1.1G | |
| Paper Lives .mp4 | 2022-02-03 17:49 | 611M | |
| Paradise Murdered .mp4 | 2023-07-23 15:13 | 1.0G | |
| Parallel Mothers .mkv | 2022-04-26 13:02 | 2.8G | |
| Passing Summer .mp4 | 2022-01-31 18:15 | 857M | |
| Past Lives .mkv | 2023-10-17 19:43 | 2.3G | |
| Pee Na 2 .mp4 | 2022-04-19 12:50 | 1.0G | |
| Pee Nak .mp4 | 2022-02-01 12:54 | 1.0G | |
| Phantom .mkv | 2023-10-17 19:42 | 2.1G | |
| Private Eye .mp4 | 2023-07-23 15:50 | 1.0G | |
| Project Wolf Hunting..> | 2022-11-06 14:50 | 1.8G | |
| R2B Return 2 .mkv | 2022-04-24 12:26 | 1.0G | |
| Raging Fire .mp4 | 2022-04-19 13:07 | 1.1G | |
| Rampant .mp4 | 2022-01-31 19:25 | 2.0G | |
| Ransomed .mkv | 2024-07-30 15:03 | 810M | |
| Reall .mp4 | 2022-01-31 18:16 | 910M | |
| Rebound .mkv | 2024-01-18 17:09 | 1.9G | |
| Recalled .mkv | 2022-01-20 10:25 | 797M | |
| Remember .mkv | 2022-12-02 12:12 | 2.0G | |
| Revenger .mp4 | 2022-04-19 12:44 | 2.0G | |
| Rurouni Kenshin Fina..> | 2022-04-19 13:08 | 1.2G | |
| Salvation .mp4 | 2022-04-19 13:08 | 725M | |
| Sankaku Mado No Soto..> | 2022-04-19 13:08 | 944M | |
| Searching For The El..> | 2023-07-23 15:52 | 1.3G | |
| Secret .mp4 | 2022-04-24 14:15 | 1.4G | |
| Seobok .mp4 | 2022-04-19 13:08 | 1.0G | |
| Serve The People .mkv | 2025-01-07 17:05 | 1.1G | |
| Serve The People .mkv | 2025-02-06 20:14 | 690M | |
| Shades Of The Heart ..> | 2022-04-19 13:09 | 759M | |
| Shock Wave .mp4 | 2022-04-18 18:06 | 875M | |
| Silenced .mkv | 2022-04-24 14:18 | 850M | |
| Slate .mp4 | 2022-02-01 15:39 | 919M | |
| Slow Video .mp4 | 2022-01-31 15:23 | 972M | |
| Smugglers .mkv | 2023-11-29 18:56 | 2.6G | |
| Snatch Up .mp4 | 2022-01-31 18:37 | 918M | |
| Snowdrop .mkv | 2022-05-28 14:35 | 2.2G | |
| Soulmate .mkv | 2023-09-22 16:19 | 1.4G | |
| Space Sweepers .mp4 | 2022-04-19 13:09 | 1.2G | |
| Steel Rain .mp4 | 2022-01-31 17:23 | 1.2G | |
| Sunny .mp4 | 2022-04-18 17:39 | 2.5G | |
| Sweet Sour .mp4 | 2022-04-19 12:58 | 940M | |
| Sympathy For Mr. Ven..> | 2023-07-23 14:07 | 2.2G | |
| Take Point .mp4 | 2022-01-31 18:16 | 1.1G | |
| Tale Of Cinema .mp4 | 2023-07-23 14:25 | 756M | |
| Tamjung Hong Gil-don..> | 2022-01-31 16:41 | 1.1G | |
| Target .mkv | 2024-01-27 18:32 | 1.7G | |
| The.Attorney .mp4 | 2022-01-31 15:05 | 1.1G | |
| The 8th Night .mkv | 2022-01-20 10:20 | 1.2G | |
| The Accidental Detec..> | 2022-01-31 18:32 | 1.0G | |
| The Admiral .mp4 | 2022-04-18 17:53 | 2.4G | |
| The Age Of Shadows .mp4 | 2022-04-18 18:00 | 2.2G | |
| The Assassin .mp4 | 2023-10-01 16:58 | 924M | |
| The Bad Guys The Mov..> | 2025-02-06 20:23 | 598M | |
| The Body .mkv | 2022-04-26 12:50 | 951M | |
| The Call .mkv | 2022-01-20 11:01 | 2.1G | |
| The Chase .mp4 | 2022-01-31 17:04 | 949M | |
| The Chaser .mp4 | 2023-07-23 15:27 | 2.2G | |
| The Childe .mp4 | 2023-10-23 16:25 | 1.1G | |
| The Classified .mp4 | 2022-01-31 15:49 | 1.0G | |
| The Classified File ..> | 2024-04-04 15:40 | 559M | |
| The Concubine .mp4 | 2022-04-18 17:42 | 1.1G | |
| The Cursed Dead Manā..> | 2022-01-20 10:16 | 1.0G | |
| The Devils Backbone ..> | 2022-04-26 13:17 | 950M | |
| The Devils Deal .mkv | 2023-11-29 18:52 | 2.2G | |
| The Drug King .mp4 | 2022-01-31 18:54 | 1.2G | |
| The Eight Hundred .mp4 | 2022-04-19 12:49 | 1.3G | |
| The Fable The Killer..> | 2022-04-19 12:59 | 1.2G | |
| The Falls .mp4 | 2022-04-19 12:59 | 1.2G | |
| The Front Line .mp4 | 2022-01-31 14:09 | 1.2G | |
| The Gangster The Cop..> | 2022-02-01 14:19 | 1.9G | |
| The Ghost Station .mkv | 2023-08-15 14:48 | 1.5G | |
| The Golden Holiday .mp4 | 2022-04-19 12:49 | 972M | |
| The Good The Bad The..> | 2023-07-23 15:27 | 2.4G | |
| The Great Battle .mp4 | 2022-01-31 19:32 | 2.9G | |
| The Hand Dual .mkv | 2024-03-20 14:44 | 305M | |
| The Handmaiden .mkv | 2022-04-24 13:04 | 1.6G | |
| The Host .mkv | 2024-02-03 17:53 | 3.1G | |
| The Host .mp4 | 2023-07-23 15:06 | 1.0G | |
| The Invisible Guest ..> | 2022-12-08 12:02 | 901M | |
| The Killer .mp4 | 2023-01-12 17:58 | 878M | |
| The Last Supper .mp4 | 2022-01-31 14:31 | 1.0G | |
| The Man From Nowhere..> | 2022-01-31 13:53 | 1.8G | |
| The Man Standing Nex..> | 2024-02-23 14:20 | 1.8G | |
| The Merciless .mp4 | 2022-01-31 17:21 | 1.0G | |
| The Moon .mkv | 2023-09-06 17:21 | 2.2G | |
| The Moon .mp4 | 2023-10-23 16:25 | 1.2G | |
| The Net .mp4 | 2022-01-31 16:38 | 1.0G | |
| The Outlaws .mp4 | 2022-01-31 17:07 | 1.0G | |
| The Paramedic .mkv | 2022-02-02 16:44 | 850M | |
| The Pension .mp4 | 2022-01-31 18:31 | 1.0G | |
| The Pirates .mkv | 2022-04-24 12:48 | 3.0G | |
| The Pirates The Last..> | 2022-04-19 15:32 | 2.3G | |
| The Platform .mp4 | 2022-04-26 13:02 | 1.8G | |
| The Point Men .mkv | 2023-07-12 14:46 | 814M | |
| The Policemans Linea..> | 2022-02-23 13:53 | 1.1G | |
| The Prison .mkv | 2024-01-27 18:32 | 2.0G | |
| The Prison .mp4 | 2022-04-18 18:06 | 1.1G | |
| The Roundup No Way O..> | 2023-07-12 14:51 | 1.8G | |
| The Roundup Punishme..> | 2024-07-30 15:04 | 814M | |
| The Secret Reunion .mp4 | 2022-04-23 18:16 | 2.2G | |
| The Silent Forest .mp4 | 2022-02-01 15:36 | 954M | |
| The Singer .mp4 | 2022-04-19 12:49 | 1.1G | |
| The Sound of Magic .mkv | 2022-05-28 14:56 | 11G | |
| The Spy Gone North .mp4 | 2022-01-31 19:29 | 2.5G | |
| The Suspect .mp4 | 2022-04-18 17:48 | 1.2G | |
| The Swordsman .mp4 | 2022-04-19 12:49 | 925M | |
| The Terror Live .mp4 | 2022-04-18 17:49 | 1.8G | |
| The Throne .mp4 | 2022-04-24 13:03 | 1.0G | |
| The Tiger .mp4 | 2022-01-31 15:59 | 1.3G | |
| The Tower .mkv | 2024-12-23 14:54 | 1.0G | |
| The Tower .mkv | 2024-12-02 14:38 | 1.0G | |
| The Trunk .mkv | 2024-12-23 15:08 | 3.4G | |
| The Trunk .mkv | 2024-12-02 14:45 | 3.4G | |
| The Vanished .mp4 | 2022-01-31 18:53 | 943M | |
| The Villainess .mp4 | 2022-01-31 17:27 | 2.0G | |
| The Wailing .mp4 | 2022-01-31 16:42 | 1.4G | |
| The Warrior .mp4 | 2023-07-23 13:57 | 1.4G | |
| The Witch Part 1 - T..> | 2022-01-31 19:14 | 1.0G | |
| The Yin ang Master D..> | 2022-04-19 12:50 | 1.2G | |
| Tidal Wave .mp4 | 2023-07-23 15:46 | 1.1G | |
| Tigers Trigger .mkv | 2025-01-07 17:05 | 1.3G | |
| Time Renegades .mp4 | 2022-04-23 17:53 | 1.0G | |
| Togo .mkv | 2022-11-11 19:16 | 670M | |
| Tomorrow .mkv | 2022-05-15 19:24 | 322M | |
| Train to Busan 2 Pen..> | 2022-01-20 10:59 | 1.0G | |
| Troll Factory .mkv | 2024-10-02 18:34 | 1.0G | |
| Tune In For Love .mp4 | 2022-02-01 12:47 | 1.1G | |
| Two .mkv | 2022-01-20 17:27 | 758M | |
| Unlocked .mkv | 2023-05-08 19:13 | 1.5G | |
| Vernostussion .mkv | 2022-12-02 14:41 | 1.4G | |
| Voice Of A Murderer ..> | 2023-07-23 15:13 | 1.1G | |
| Warriors Of The Dawn..> | 2022-01-31 17:05 | 1.2G | |
| What Happened To Mr ..> | 2022-04-19 12:59 | 939M | |
| Whispering Corridors..> | 2022-04-19 12:59 | 722M | |
| Wifes Friend Reunion..> | 2022-01-31 17:02 | 956M | |
| Winters Night .mp4 | 2022-01-31 17:44 | 844M | |
| Woman Is The Future ..> | 2023-07-23 14:25 | 743M | |
| Wonderful Radio .mp4 | 2022-04-18 17:43 | 1.1G | |
| Wonderland (2024) 72..> | 2024-09-22 18:18 | 1.5G | |
| Wonderland.2024.Dual..> | 2024-07-30 15:02 | 890M | |
| Yaksha Ruthless Oper..> | 2022-04-19 15:30 | 1.1G | |
| You Call It Passion ..> | 2024-11-24 15:58 | 1.0G | |
| Young Adult Matters ..> | 2022-02-01 15:43 | 1.1G | |
| Yunhui ege .mp4 | 2022-04-19 12:43 | 964M | |
| Zombie For Sale .mp4 | 2022-02-01 12:54 | 1.0G | |
| heroic losers .mkv | 2022-02-02 16:27 | 868M | |